C22H18Cl2N2 — CID 21374727
(Z)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21374727) has the molecular formula C22H18Cl2N2 and a molecular weight of 381.31 g/mol. Its IUPAC name is (Z)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21374727 |
| Molecular Formula | C22H18Cl2N2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (Z)-3-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C(C#N)=C/c2cc(C)n(-c3ccc(Cl)c(Cl)c3)c2C)cc1 |
| InChI | InChI=1S/C22H18Cl2N2/c1-14-4-6-17(7-5-14)19(13-25)11-18-10-15(2)26(16(18)3)20-8-9-21(23)22(24)12-20/h4-12H,1-3H3/b19-11+ |
| InChIKey | OQXPPIPXGIJIQJ-YBFXNURJSA-N |
| XLogP | 6.77 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|