C26H29N3 — CID 21375128
(E)-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21375128) has the molecular formula C26H29N3 and a molecular weight of 383.54 g/mol. Its IUPAC name is (E)-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21375128 |
| Molecular Formula | C26H29N3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | (E)-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(/C=C(/C#N)c3ccc(C)cc3)c2C)cc1 |
| InChI | InChI=1S/C26H29N3/c1-6-28(7-2)25-12-14-26(15-13-25)29-20(4)16-23(21(29)5)17-24(18-27)22-10-8-19(3)9-11-22/h8-17H,6-7H2,1-5H3/b24-17- |
| InChIKey | XCCPYSYFPNOYKB-ULJHMMPZSA-N |
| XLogP | 6.31 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|