C24H22N3O2- — CID 7372237
4-[(E)-1-cyano-2-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]ethenyl]benzoate (PubChem CID 7372237) has the molecular formula C24H22N3O2- and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-[(E)-1-cyano-2-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]ethenyl]benzoate.
| Compound Name | 4-[(E)-1-cyano-2-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 7372237 |
| Molecular Formula | C24H22N3O2- |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-[(E)-1-cyano-2-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]ethenyl]benzoate |
| SMILES | Cc1cc(/C=C(/C#N)c2ccc(C(=O)[O-])cc2)c(C)n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-16-13-20(14-21(15-25)18-5-7-19(8-6-18)24(28)29)17(2)27(16)23-11-9-22(10-12-23)26(3)4/h5-14H,1-4H3,(H,28,29)/p-1/b21-14- |
| InChIKey | IVFKIAGYBXCYJA-STZFKDTASA-M |
| XLogP | 3.59 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|