C21H17FN2 — CID 3115768
3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-phenylprop-2-enenitrile (PubChem CID 3115768) has the molecular formula C21H17FN2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-phenylprop-2-enenitrile.
| Compound Name | 3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 3115768 |
| Molecular Formula | C21H17FN2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-phenylprop-2-enenitrile |
| SMILES | Cc1cc(C=C(C#N)c2ccccc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2/c1-15-12-18(13-19(14-23)17-6-4-3-5-7-17)16(2)24(15)21-10-8-20(22)9-11-21/h3-13H,1-2H3 |
| InChIKey | JLIYQSRBMSULKM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|