C24H18FN5OS — CID 3780090
N-[5-[1-cyano-2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 3780090) has the molecular formula C24H18FN5OS and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[5-[1-cyano-2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[1-cyano-2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3780090 |
| Molecular Formula | C24H18FN5OS |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-[5-[1-cyano-2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1cc(C=C(C#N)c2nnc(NC(=O)c3ccccc3)s2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H18FN5OS/c1-15-12-18(16(2)30(15)21-10-8-20(25)9-11-21)13-19(14-26)23-28-29-24(32-23)27-22(31)17-6-4-3-5-7-17/h3-13H,1-2H3,(H,27,29,31) |
| InChIKey | OWHSTRDODGULAJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|