C19H14F3N5OS — CID 170910930
(Z)-2-cyano-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170910930) has the molecular formula C19H14F3N5OS and a molecular weight of 417.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170910930 |
| Molecular Formula | C19H14F3N5OS |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2nnc(C(F)(F)F)s2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C19H14F3N5OS/c1-11-8-13(12(2)27(11)15-6-4-3-5-7-15)9-14(10-23)16(28)24-18-26-25-17(29-18)19(20,21)22/h3-9H,1-2H3,(H,24,26,28)/b14-9- |
| InChIKey | BGBFVBIECQRZBU-ZROIWOOFSA-N |
| XLogP | 4.51 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|