C15H11F3N4O3S — CID 170918277
(Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170918277) has the molecular formula C15H11F3N4O3S and a molecular weight of 384.34 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170918277 |
| Molecular Formula | C15H11F3N4O3S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C(/C#N)C(=O)Nc2nnc(C(F)(F)F)s2)c1 |
| InChI | InChI=1S/C15H11F3N4O3S/c1-24-10-3-4-11(25-2)8(6-10)5-9(7-19)12(23)20-14-22-21-13(26-14)15(16,17)18/h3-6H,1-2H3,(H,20,22,23)/b9-5- |
| InChIKey | PRPWOAKNPYIBMQ-UITAMQMPSA-N |
| XLogP | 3.12 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|