C21H14ClF3N4O3S — CID 170911797
(Z)-3-[3-[2-(2-chlorophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170911797) has the molecular formula C21H14ClF3N4O3S and a molecular weight of 494.88 g/mol. Its IUPAC name is (Z)-3-[3-[2-(2-chlorophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-3-[3-[2-(2-chlorophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170911797 |
| Molecular Formula | C21H14ClF3N4O3S |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | (Z)-3-[3-[2-(2-chlorophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cccc(OCCOc2ccccc2Cl)c1)C(=O)Nc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C21H14ClF3N4O3S/c22-16-6-1-2-7-17(16)32-9-8-31-15-5-3-4-13(11-15)10-14(12-26)18(30)27-20-29-28-19(33-20)21(23,24)25/h1-7,10-11H,8-9H2,(H,27,29,30)/b14-10- |
| InChIKey | QUDDCMQDBXIARE-UVTDQMKNSA-N |
| XLogP | 5.21 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|