C24H23BrN4O3S — CID 170910593
(Z)-3-[3-[2-(4-bromophenoxy)ethoxy]phenyl]-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide (PubChem CID 170910593) has the molecular formula C24H23BrN4O3S and a molecular weight of 527.44 g/mol. Its IUPAC name is (Z)-3-[3-[2-(4-bromophenoxy)ethoxy]phenyl]-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-[2-(4-bromophenoxy)ethoxy]phenyl]-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 170910593 |
| Molecular Formula | C24H23BrN4O3S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | (Z)-3-[3-[2-(4-bromophenoxy)ethoxy]phenyl]-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide |
| SMILES | CCCCc1nnc(NC(=O)/C(C#N)=C\c2cccc(OCCOc3ccc(Br)cc3)c2)s1 |
| InChI | InChI=1S/C24H23BrN4O3S/c1-2-3-7-22-28-29-24(33-22)27-23(30)18(16-26)14-17-5-4-6-21(15-17)32-13-12-31-20-10-8-19(25)9-11-20/h4-6,8-11,14-15H,2-3,7,12-13H2,1H3,(H,27,29,30)/b18-14- |
| InChIKey | OSDASRVRUQDHFO-JXAWBTAJSA-N |
| XLogP | 5.65 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|