C25H25ClN4O4S — CID 170910589
(Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2-cyanoprop-2-enamide (PubChem CID 170910589) has the molecular formula C25H25ClN4O4S and a molecular weight of 513.02 g/mol. Its IUPAC name is (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 170910589 |
| Molecular Formula | C25H25ClN4O4S |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2-cyanoprop-2-enamide |
| SMILES | CCCCc1nnc(NC(=O)/C(C#N)=C\c2cc(Cl)c(OCCOc3ccccc3)c(OC)c2)s1 |
| InChI | InChI=1S/C25H25ClN4O4S/c1-3-4-10-22-29-30-25(35-22)28-24(31)18(16-27)13-17-14-20(26)23(21(15-17)32-2)34-12-11-33-19-8-6-5-7-9-19/h5-9,13-15H,3-4,10-12H2,1-2H3,(H,28,30,31)/b18-13- |
| InChIKey | MTYUKBKNJXETOB-AQTBWJFISA-N |
| XLogP | 5.55 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|