C23H20Cl2N4O4S — CID 170911726
(Z)-3-[3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170911726) has the molecular formula C23H20Cl2N4O4S and a molecular weight of 519.41 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170911726 |
| Molecular Formula | C23H20Cl2N4O4S |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | (Z)-3-[3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(C)s2)cc(Cl)c1OCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C23H20Cl2N4O4S/c1-13-8-17(4-5-18(13)24)32-6-7-33-21-19(25)10-15(11-20(21)31-3)9-16(12-26)22(30)27-23-29-28-14(2)34-23/h4-5,8-11H,6-7H2,1-3H3,(H,27,29,30)/b16-9- |
| InChIKey | HMGKKCZZSPHRKC-SXGWCWSVSA-N |
| XLogP | 5.47 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|