C26H27ClN4O5S — CID 170910660
(Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enamide (PubChem CID 170910660) has the molecular formula C26H27ClN4O5S and a molecular weight of 543.05 g/mol. Its IUPAC name is (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 170910660 |
| Molecular Formula | C26H27ClN4O5S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enamide |
| SMILES | CCCCc1nnc(NC(=O)/C(C#N)=C\c2cc(Cl)c(OCCOc3ccc(OC)cc3)c(OC)c2)s1 |
| InChI | InChI=1S/C26H27ClN4O5S/c1-4-5-6-23-30-31-26(37-23)29-25(32)18(16-28)13-17-14-21(27)24(22(15-17)34-3)36-12-11-35-20-9-7-19(33-2)8-10-20/h7-10,13-15H,4-6,11-12H2,1-3H3,(H,29,31,32)/b18-13- |
| InChIKey | WMPDHMKXXBWQAI-AQTBWJFISA-N |
| XLogP | 5.55 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|