C24H23ClN4O5S — CID 171331530
3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171331530) has the molecular formula C24H23ClN4O5S and a molecular weight of 514.99 g/mol. Its IUPAC name is 3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171331530 |
| Molecular Formula | C24H23ClN4O5S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 3-[3-chloro-5-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCc1nnc(NC(=O)C(C#N)=Cc2cc(Cl)c(OCCOc3ccc(OC)cc3)c(OC)c2)s1 |
| InChI | InChI=1S/C24H23ClN4O5S/c1-4-21-28-29-24(35-21)27-23(30)16(14-26)11-15-12-19(25)22(20(13-15)32-3)34-10-9-33-18-7-5-17(31-2)6-8-18/h5-8,11-13H,4,9-10H2,1-3H3,(H,27,29,30) |
| InChIKey | YAEFEGGCVNBUGT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|