C26H27IN4O4S — CID 170916080
(Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170916080) has the molecular formula C26H27IN4O4S and a molecular weight of 618.50 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916080 |
| Molecular Formula | C26H27IN4O4S |
| Molecular Weight | 618.50 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | (Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-iodo-5-methoxyphenyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCc1cc(C)cc(OCCOc2c(I)cc(/C=C(/C#N)C(=O)Nc3nnc(CC)s3)cc2OC)c1 |
| InChI | InChI=1S/C26H27IN4O4S/c1-5-17-9-16(3)10-20(12-17)34-7-8-35-24-21(27)13-18(14-22(24)33-4)11-19(15-28)25(32)29-26-31-30-23(6-2)36-26/h9-14H,5-8H2,1-4H3,(H,29,31,32)/b19-11- |
| InChIKey | AVIXYDXNGGLZFW-ODLFYWEKSA-N |
| XLogP | 5.59 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|