C24H24N4O7S2 — CID 170913305
(Z)-2-cyano-3-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170913305) has the molecular formula C24H24N4O7S2 and a molecular weight of 544.61 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913305 |
| Molecular Formula | C24H24N4O7S2 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-dimethoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)cc(OC)c1OCCOc1cccc(C)c1 |
| InChI | InChI=1S/C24H24N4O7S2/c1-15-6-5-7-18(10-15)34-8-9-35-21-19(32-2)12-16(13-20(21)33-3)11-17(14-25)22(29)26-23-27-28-24(36-23)37(4,30)31/h5-7,10-13H,8-9H2,1-4H3,(H,26,27,29)/b17-11- |
| InChIKey | XTEHJUPJHJZXEC-BOPFTXTBSA-N |
| XLogP | 3.27 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|