C23H22N4O5S2 — CID 171332708
2-cyano-3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171332708) has the molecular formula C23H22N4O5S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332708 |
| Molecular Formula | C23H22N4O5S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-cyano-3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(C)c(OCCOc2ccc(C=C(C#N)C(=O)Nc3nnc(S(C)(=O)=O)s3)cc2)c1 |
| InChI | InChI=1S/C23H22N4O5S2/c1-15-4-5-16(2)20(12-15)32-11-10-31-19-8-6-17(7-9-19)13-18(14-24)21(28)25-22-26-27-23(33-22)34(3,29)30/h4-9,12-13H,10-11H2,1-3H3,(H,25,26,28) |
| InChIKey | BAPZIENLULAHAM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|