C25H25N5O6S — CID 170916228
(Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3,5-dimethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170916228) has the molecular formula C25H25N5O6S and a molecular weight of 523.57 g/mol. Its IUPAC name is (Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3,5-dimethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3,5-dimethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916228 |
| Molecular Formula | C25H25N5O6S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | (Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3,5-dimethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(C)s2)cc(OC)c1OCCOc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C25H25N5O6S/c1-15(31)27-19-5-7-20(8-6-19)35-9-10-36-23-21(33-3)12-17(13-22(23)34-4)11-18(14-26)24(32)28-25-30-29-16(2)37-25/h5-8,11-13H,9-10H2,1-4H3,(H,27,31)(H,28,30,32)/b18-11- |
| InChIKey | CRQUWVWTFXOXBH-WQRHYEAKSA-N |
| XLogP | 3.83 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|