C26H21N5O5S — CID 171333239
3-[4-[2-(4-acetamidophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 171333239) has the molecular formula C26H21N5O5S and a molecular weight of 515.55 g/mol. Its IUPAC name is 3-[4-[2-(4-acetamidophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-[4-[2-(4-acetamidophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171333239 |
| Molecular Formula | C26H21N5O5S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 3-[4-[2-(4-acetamidophenoxy)ethoxy]phenyl]-2-cyano-N-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(OCCOc2ccc(C=C(C#N)C(=O)Nc3nnc(-c4ccco4)s3)cc2)cc1 |
| InChI | InChI=1S/C26H21N5O5S/c1-17(32)28-20-6-10-22(11-7-20)35-14-13-34-21-8-4-18(5-9-21)15-19(16-27)24(33)29-26-31-30-25(37-26)23-3-2-12-36-23/h2-12,15H,13-14H2,1H3,(H,28,32)(H,29,31,33) |
| InChIKey | USPXYBFSLLFKKR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|