C20H24N4O2S2 — CID 19227353
(E)-3-(4-butoxyphenyl)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide (PubChem CID 19227353) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is (E)-3-(4-butoxyphenyl)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(4-butoxyphenyl)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 19227353 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (E)-3-(4-butoxyphenyl)-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-cyanoprop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C(\C#N)C(=O)Nc2nnc(SCCCC)s2)cc1 |
| InChI | InChI=1S/C20H24N4O2S2/c1-3-5-11-26-17-9-7-15(8-10-17)13-16(14-21)18(25)22-19-23-24-20(28-19)27-12-6-4-2/h7-10,13H,3-6,11-12H2,1-2H3,(H,22,23,25)/b16-13+ |
| InChIKey | GKHYOKCPVUQACH-DTQAZKPQSA-N |
| XLogP | 5.15 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|