C26H32N2O2 — CID 19175199
(E)-3-(4-butoxyphenyl)-2-cyano-N-[2,6-di(propan-2-yl)phenyl]prop-2-enamide (PubChem CID 19175199) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is (E)-3-(4-butoxyphenyl)-2-cyano-N-[2,6-di(propan-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-butoxyphenyl)-2-cyano-N-[2,6-di(propan-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19175199 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | (E)-3-(4-butoxyphenyl)-2-cyano-N-[2,6-di(propan-2-yl)phenyl]prop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C(\C#N)C(=O)Nc2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C26H32N2O2/c1-6-7-15-30-22-13-11-20(12-14-22)16-21(17-27)26(29)28-25-23(18(2)3)9-8-10-24(25)19(4)5/h8-14,16,18-19H,6-7,15H2,1-5H3,(H,28,29)/b21-16+ |
| InChIKey | SZTYNTDGRPNRQW-LTGZKZEYSA-N |
| XLogP | 6.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|