C24H28N2O2 — CID 4129645
2-cyano-3-(4-hexoxyphenyl)-N-(1-phenylethyl)prop-2-enamide (PubChem CID 4129645) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-cyano-3-(4-hexoxyphenyl)-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(4-hexoxyphenyl)-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 4129645 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-cyano-3-(4-hexoxyphenyl)-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(C=C(C#N)C(=O)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-4-5-9-16-28-23-14-12-20(13-15-23)17-22(18-25)24(27)26-19(2)21-10-7-6-8-11-21/h6-8,10-15,17,19H,3-5,9,16H2,1-2H3,(H,26,27) |
| InChIKey | OQLSRKSQKJFYBV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|