C24H20N2O — CID 2095128
(E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(4-phenylphenyl)prop-2-enamide (PubChem CID 2095128) has the molecular formula C24H20N2O and a molecular weight of 352.44 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(4-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2095128 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (E)-2-cyano-N-[(1S)-1-phenylethyl]-3-(4-phenylphenyl)prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C(C#N)=C/c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O/c1-18(20-8-4-2-5-9-20)26-24(27)23(17-25)16-19-12-14-22(15-13-19)21-10-6-3-7-11-21/h2-16,18H,1H3,(H,26,27)/b23-16+/t18-/m0/s1 |
| InChIKey | KNYFOZDMDGOSDQ-RPNTZMPASA-N |
| XLogP | 5.14 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|