C19H18N2O — CID 94841508
(Z)-2-cyano-3-(2-methylphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 94841508) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-methylphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-methylphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 94841508 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (Z)-2-cyano-3-(2-methylphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | Cc1ccccc1/C=C(/C#N)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O/c1-14-8-6-7-11-17(14)12-18(13-20)19(22)21-15(2)16-9-4-3-5-10-16/h3-12,15H,1-2H3,(H,21,22)/b18-12-/t15-/m0/s1 |
| InChIKey | RMDIBCNGTCQMBZ-BRYHAGSVSA-N |
| XLogP | 3.78 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|