C20H23N3O — CID 124928722
(Z)-2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 124928722) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 124928722 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (Z)-2-cyano-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | CCn1c(C)cc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)c1C |
| InChI | InChI=1S/C20H23N3O/c1-5-23-14(2)11-18(16(23)4)12-19(13-21)20(24)22-15(3)17-9-7-6-8-10-17/h6-12,15H,5H2,1-4H3,(H,22,24)/b19-12-/t15-/m0/s1 |
| InChIKey | JVIPNJHCBOEYJO-CCRNYGKSSA-N |
| XLogP | 3.91 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|