C27H29N3O — CID 16549344
(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[(4-methylphenyl)-phenylmethyl]prop-2-enamide (PubChem CID 16549344) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[(4-methylphenyl)-phenylmethyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[(4-methylphenyl)-phenylmethyl]prop-2-enamide |
|---|---|
| PubChem CID | 16549344 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[(4-methylphenyl)-phenylmethyl]prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)NC(c2ccccc2)c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C27H29N3O/c1-5-15-30-20(3)16-24(21(30)4)17-25(18-28)27(31)29-26(22-9-7-6-8-10-22)23-13-11-19(2)12-14-23/h6-14,16-17,26H,5,15H2,1-4H3,(H,29,31)/b25-17+ |
| InChIKey | FIRXRUPTPVHFDS-KOEQRZSOSA-N |
| XLogP | 5.64 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|