C22H28N4O — CID 55447215
(Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(N-methylanilino)ethyl]prop-2-enamide (PubChem CID 55447215) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(N-methylanilino)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(N-methylanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55447215 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(N-methylanilino)ethyl]prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(/C#N)C(=O)NCCN(C)c2ccccc2)c1C |
| InChI | InChI=1S/C22H28N4O/c1-5-12-26-17(2)14-19(18(26)3)15-20(16-23)22(27)24-11-13-25(4)21-9-7-6-8-10-21/h6-10,14-15H,5,11-13H2,1-4H3,(H,24,27)/b20-15- |
| InChIKey | WLKKBQVAIULOGS-HKWRFOASSA-N |
| XLogP | 3.67 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|