C22H27N5O2 — CID 78779239
N'-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide (PubChem CID 78779239) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N'-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide.
| Compound Name | N'-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide |
|---|---|
| PubChem CID | 78779239 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N'-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide |
| SMILES | CCCn1c(C)cc(C=C(C#N)C(=O)NNC(=O)c2cccc(N(C)C)c2)c1C |
| InChI | InChI=1S/C22H27N5O2/c1-6-10-27-15(2)11-18(16(27)3)12-19(14-23)22(29)25-24-21(28)17-8-7-9-20(13-17)26(4)5/h7-9,11-13H,6,10H2,1-5H3,(H,24,28)(H,25,29) |
| InChIKey | QLACTGXWVNEDQE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|