C20H22FN3O — CID 16551397
(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide (PubChem CID 16551397) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16551397 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)Nc2ccc(F)cc2C)c1C |
| InChI | InChI=1S/C20H22FN3O/c1-5-8-24-14(3)10-16(15(24)4)11-17(12-22)20(25)23-19-7-6-18(21)9-13(19)2/h6-7,9-11H,5,8H2,1-4H3,(H,23,25)/b17-11+ |
| InChIKey | MIMJQXBEEYFQSD-GZTJUZNOSA-N |
| XLogP | 4.51 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|