C20H21ClFN3O — CID 134059488
(E)-N-(2-chloro-4-fluorophenyl)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide (PubChem CID 134059488) has the molecular formula C20H21ClFN3O and a molecular weight of 373.86 g/mol. Its IUPAC name is (E)-N-(2-chloro-4-fluorophenyl)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-4-fluorophenyl)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 134059488 |
| Molecular Formula | C20H21ClFN3O |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (E)-N-(2-chloro-4-fluorophenyl)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)Nc2ccc(F)cc2Cl)c(C)n1CC(C)C |
| InChI | InChI=1S/C20H21ClFN3O/c1-12(2)11-25-13(3)7-15(14(25)4)8-16(10-23)20(26)24-19-6-5-17(22)9-18(19)21/h5-9,12H,11H2,1-4H3,(H,24,26)/b16-8+ |
| InChIKey | BVBULXPVRCDDRD-LZYBPNLTSA-N |
| XLogP | 5.10 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|