C27H27N5O2 — CID 55764130
(E)-2-cyano-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide (PubChem CID 55764130) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55764130 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (E)-2-cyano-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)/C(C#N)=C/c1cc(C)n(CC(C)C)c1C |
| InChI | InChI=1S/C27H27N5O2/c1-17(2)16-32-19(4)12-22(20(32)5)13-23(15-29)26(33)31-25-9-8-24(11-18(25)3)34-27-21(14-28)7-6-10-30-27/h6-13,17H,16H2,1-5H3,(H,31,33)/b23-13+ |
| InChIKey | GHXDJRSUNJYVLW-YDZHTSKRSA-N |
| XLogP | 5.67 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|