C22H24N6O — CID 55581212
(Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[2-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide (PubChem CID 55581212) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[2-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[2-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55581212 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[2-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2ccccc2-n2cncn2)c(C)n1CC(C)C |
| InChI | InChI=1S/C22H24N6O/c1-15(2)12-27-16(3)9-18(17(27)4)10-19(11-23)22(29)26-20-7-5-6-8-21(20)28-14-24-13-25-28/h5-10,13-15H,12H2,1-4H3,(H,26,29)/b19-10- |
| InChIKey | VLZDCAMOCDEOTB-GRSHGNNSSA-N |
| XLogP | 3.89 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|