C25H30N4O3 — CID 76884327
2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide (PubChem CID 76884327) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76884327 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)Nc2ccc(C(=O)N3CCOCC3)cc2)c(C)n1CC(C)C |
| InChI | InChI=1S/C25H30N4O3/c1-17(2)16-29-18(3)13-21(19(29)4)14-22(15-26)24(30)27-23-7-5-20(6-8-23)25(31)28-9-11-32-12-10-28/h5-8,13-14,17H,9-12,16H2,1-4H3,(H,27,30) |
| InChIKey | HLPHTBXZWCTMHN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|