C22H24N4O3 — CID 8884799
4-[[(E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoyl]amino]benzamide (PubChem CID 8884799) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoyl]amino]benzamide.
| Compound Name | 4-[[(E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 8884799 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-[[(E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoyl]amino]benzamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)Nc2ccc(C(N)=O)cc2)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H24N4O3/c1-14-10-17(15(2)26(14)13-20-4-3-9-29-20)11-18(12-23)22(28)25-19-7-5-16(6-8-19)21(24)27/h5-8,10-11,20H,3-4,9,13H2,1-2H3,(H2,24,27)(H,25,28)/b18-11+/t20-/m0/s1 |
| InChIKey | SDNBSDZFNJPAAP-OBXYEHHASA-N |
| XLogP | 2.93 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|