C21H28N2O4 — CID 78769309
oxan-2-ylmethyl (Z)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 78769309) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is oxan-2-ylmethyl (Z)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | oxan-2-ylmethyl (Z)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 78769309 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | oxan-2-ylmethyl (Z)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)OCC2CCCCO2)c(C)n1CC1CCCO1 |
| InChI | InChI=1S/C21H28N2O4/c1-15-10-17(16(2)23(15)13-19-7-5-9-25-19)11-18(12-22)21(24)27-14-20-6-3-4-8-26-20/h10-11,19-20H,3-9,13-14H2,1-2H3/b18-11- |
| InChIKey | HFCMVRWUXMSMBH-WQRHYEAKSA-N |
| XLogP | 3.30 |
| TPSA | 73.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|