C23H25FN2O4 — CID 7961284
2-(4-fluorophenoxy)ethyl (E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoate (PubChem CID 7961284) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl (E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoate.
| Compound Name | 2-(4-fluorophenoxy)ethyl (E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7961284 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl (E)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCCOc2ccc(F)cc2)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C23H25FN2O4/c1-16-12-18(17(2)26(16)15-22-4-3-9-28-22)13-19(14-25)23(27)30-11-10-29-21-7-5-20(24)6-8-21/h5-8,12-13,22H,3-4,9-11,15H2,1-2H3/b19-13+/t22-/m0/s1 |
| InChIKey | CHKIIVRRYQAWHM-JJEHFPDLSA-N |
| XLogP | 3.95 |
| TPSA | 73.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|