C22H23N3O4 — CID 8700940
(E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enamide (PubChem CID 8700940) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 8700940 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)Nc2ccc3c(c2)OCO3)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H23N3O4/c1-14-8-16(15(2)25(14)12-19-4-3-7-27-19)9-17(11-23)22(26)24-18-5-6-20-21(10-18)29-13-28-20/h5-6,8-10,19H,3-4,7,12-13H2,1-2H3,(H,24,26)/b17-9+/t19-/m0/s1 |
| InChIKey | HRMQDCXDPQXZMG-OJEAVSNDSA-N |
| XLogP | 3.56 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|