C25H30N4O3 — CID 42146993
(E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 42146993) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 42146993 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C(C#N)=C/c2cc(C)n(CC(C)C)c2C)ccc1N1CCCC1=O |
| InChI | InChI=1S/C25H30N4O3/c1-16(2)15-29-17(3)11-19(18(29)4)12-20(14-26)25(31)27-21-8-9-22(23(13-21)32-5)28-10-6-7-24(28)30/h8-9,11-13,16H,6-7,10,15H2,1-5H3,(H,27,31)/b20-12+ |
| InChIKey | LJUQLOWNMNZOCE-UDWIEESQSA-N |
| XLogP | 4.44 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|