C20H21N3O5 — CID 30679370
N'-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-N-(4-methoxyphenyl)oxamide (PubChem CID 30679370) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N'-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-N-(4-methoxyphenyl)oxamide.
| Compound Name | N'-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-N-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 30679370 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N'-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-N-(4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2ccc(N3CCCC3=O)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H21N3O5/c1-27-15-8-5-13(6-9-15)21-19(25)20(26)22-14-7-10-16(17(12-14)28-2)23-11-3-4-18(23)24/h5-10,12H,3-4,11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | XTQIZQJMYRKRCK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|