C20H21N3O4 — CID 30679288
N-(3-methoxyphenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide (PubChem CID 30679288) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide.
| Compound Name | N-(3-methoxyphenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 30679288 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(3-methoxyphenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)Nc2ccc(N3CCCC3=O)c(C)c2)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-13-11-15(8-9-17(13)23-10-4-7-18(23)24)22-20(26)19(25)21-14-5-3-6-16(12-14)27-2/h3,5-6,8-9,11-12H,4,7,10H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | NMXPQUAWHGMPQA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|