C19H18FN3O3 — CID 30679287
N-(3-fluorophenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide (PubChem CID 30679287) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide.
| Compound Name | N-(3-fluorophenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 30679287 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-(3-fluorophenyl)-N'-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2cccc(F)c2)ccc1N1CCCC1=O |
| InChI | InChI=1S/C19H18FN3O3/c1-12-10-15(7-8-16(12)23-9-3-6-17(23)24)22-19(26)18(25)21-14-5-2-4-13(20)11-14/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | NDDPDEUKGFIEIC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|