C19H15N5O — CID 52555357
(Z)-2-cyano-N-(2-methylphenyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide (PubChem CID 52555357) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-methylphenyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-methylphenyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 52555357 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (Z)-2-cyano-N-(2-methylphenyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C\c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C19H15N5O/c1-14-4-2-3-5-18(14)23-19(25)16(11-20)10-15-6-8-17(9-7-15)24-13-21-12-22-24/h2-10,12-13H,1H3,(H,23,25)/b16-10- |
| InChIKey | ZRIZEZVKQGDCMD-YBEGLDIGSA-N |
| XLogP | 3.12 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|