C18H10Cl2N4O — CID 134040824
(E)-2-(2,6-dichlorobenzoyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enenitrile (PubChem CID 134040824) has the molecular formula C18H10Cl2N4O and a molecular weight of 369.21 g/mol. Its IUPAC name is (E)-2-(2,6-dichlorobenzoyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(2,6-dichlorobenzoyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 134040824 |
| Molecular Formula | C18H10Cl2N4O |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | (E)-2-(2,6-dichlorobenzoyl)-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-n2cncn2)cc1)C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H10Cl2N4O/c19-15-2-1-3-16(20)17(15)18(25)13(9-21)8-12-4-6-14(7-5-12)24-11-22-10-23-24/h1-8,10-11H/b13-8+ |
| InChIKey | LJKKNPGPXVYDDZ-MDWZMJQESA-N |
| XLogP | 4.36 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|