C19H15N5O — CID 76858246
N-benzyl-2-cyano-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide (PubChem CID 76858246) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is N-benzyl-2-cyano-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-benzyl-2-cyano-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76858246 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-benzyl-2-cyano-3-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-n2cncn2)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H15N5O/c20-11-17(19(25)22-12-16-4-2-1-3-5-16)10-15-6-8-18(9-7-15)24-14-21-13-23-24/h1-10,13-14H,12H2,(H,22,25) |
| InChIKey | FGUIYTDOKHQVTG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|