C16H15ClN4O — CID 72685386
N-benzyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 72685386) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is N-benzyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | N-benzyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 72685386 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-benzyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | N#CC(=Cc1cnn(CCCl)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H15ClN4O/c17-6-7-21-12-14(11-20-21)8-15(9-18)16(22)19-10-13-4-2-1-3-5-13/h1-5,8,11-12H,6-7,10H2,(H,19,22) |
| InChIKey | XUNOHSGLVSGOKH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|