C13H17ClN4O — CID 75855044
N-butyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 75855044) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is N-butyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | N-butyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 75855044 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-butyl-3-[1-(2-chloroethyl)pyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | CCCCNC(=O)C(C#N)=Cc1cnn(CCCl)c1 |
| InChI | InChI=1S/C13H17ClN4O/c1-2-3-5-16-13(19)12(8-15)7-11-9-17-18(10-11)6-4-14/h7,9-10H,2-6H2,1H3,(H,16,19) |
| InChIKey | VIYYPOHWPJTPDO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|