C13H15N3O — CID 5020774
N-butyl-2-cyano-3-pyridin-3-ylprop-2-enamide (PubChem CID 5020774) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is N-butyl-2-cyano-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-butyl-2-cyano-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 5020774 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-butyl-2-cyano-3-pyridin-3-ylprop-2-enamide |
| SMILES | CCCCNC(=O)C(C#N)=Cc1cccnc1 |
| InChI | InChI=1S/C13H15N3O/c1-2-3-7-16-13(17)12(9-14)8-11-5-4-6-15-10-11/h4-6,8,10H,2-3,7H2,1H3,(H,16,17) |
| InChIKey | QPYQQLJBTBIDFW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|