C13H14N2O — CID 4987027
4,4-dimethyl-3-oxo-2-(pyridin-3-ylmethylidene)pentanenitrile (PubChem CID 4987027) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 4,4-dimethyl-3-oxo-2-(pyridin-3-ylmethylidene)pentanenitrile.
| Compound Name | 4,4-dimethyl-3-oxo-2-(pyridin-3-ylmethylidene)pentanenitrile |
|---|---|
| PubChem CID | 4987027 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4,4-dimethyl-3-oxo-2-(pyridin-3-ylmethylidene)pentanenitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)=Cc1cccnc1 |
| InChI | InChI=1S/C13H14N2O/c1-13(2,3)12(16)11(8-14)7-10-5-4-6-15-9-10/h4-7,9H,1-3H3 |
| InChIKey | NNDPQNVZKPHVFM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|