C18H25N3O — CID 4806187
N-butyl-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide (PubChem CID 4806187) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-butyl-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide.
| Compound Name | N-butyl-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4806187 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-butyl-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide |
| SMILES | CCCCNC(=O)C(C#N)=Cc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C18H25N3O/c1-4-7-12-20-18(22)16(14-19)13-15-8-10-17(11-9-15)21(5-2)6-3/h8-11,13H,4-7,12H2,1-3H3,(H,20,22) |
| InChIKey | QWRSICYUWFUFCB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|