C18H24N2O2 — CID 90475180
butyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate (PubChem CID 90475180) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is butyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate.
| Compound Name | butyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90475180 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | butyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C(C#N)=C/c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-4-7-12-22-18(21)16(14-19)13-15-8-10-17(11-9-15)20(5-2)6-3/h8-11,13H,4-7,12H2,1-3H3/b16-13+ |
| InChIKey | IRYSONACDQXTSV-DTQAZKPQSA-N |
| XLogP | 3.78 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|