C23H34N3O4+ — CID 3023173
3-acetyloxypropyl-[2-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyethyl]-dimethylazanium (PubChem CID 3023173) has the molecular formula C23H34N3O4+ and a molecular weight of 416.54 g/mol. Its IUPAC name is 3-acetyloxypropyl-[2-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyethyl]-dimethylazanium.
| Compound Name | 3-acetyloxypropyl-[2-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 3023173 |
| Molecular Formula | C23H34N3O4+ |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 3-acetyloxypropyl-[2-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyethyl]-dimethylazanium |
| SMILES | CCN(CC)c1ccc(C=C(C#N)C(=O)OCC[N+](C)(C)CCCOC(C)=O)cc1 |
| InChI | InChI=1S/C23H34N3O4/c1-6-25(7-2)22-11-9-20(10-12-22)17-21(18-24)23(28)30-16-14-26(4,5)13-8-15-29-19(3)27/h9-12,17H,6-8,13-16H2,1-5H3/q+1 |
| InChIKey | GCVKWUUBWFDPRG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|